Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
| Linear Formula | K2HPO4 |
|---|---|
| Molecular Weight (g/mol) | 174.18 |
| ChEBI | CHEBI:32031 |
| Chemical Name or Material | Potassium phosphate, dibasic |
| SMILES | OP(=O)([O-])[O-].[K+].[K+] |
| Merck Index | 15, 7779 |
| InChI Key | ZPWVASYFFYYZEW-UHFFFAOYSA-L |
| Density | 1.1300g/mL |
| Appearance | Clear colorless solution |
| PubChem CID | 24450 |
| Concentration or Composition (by Analyte or Components) | 1.0M, exact strength on the certificate of analysis |
| CAS | 7732-18-5 |
| MDL Number | MFCD00011383 |
| Packaging | Glass bottle |
| Synonym | dipotassium hydrogen phosphate,dipotassium phosphate,dipotassium hydrogenphosphate,dibasic potassium phosphate,potassium hydrogen phosphate,potassium phosphate, dibasic,potassium dibasic phosphate,potassium phosphate dibasic,phosphoric acid, dipotassium salt,dipotassium monophosphate |
| IUPAC Name | dipotassium;hydrogen phosphate |
| Molecular Formula | HK2O4P |
| EINECS Number | 231-834-5 |
| Formula Weight | 174.18 |
| Specific Gravity | 1.13 |
Sodium Chloride, ACS Reagent Grade, Ricca Chemical
CAS: 7647-14-5 Molecular Formula: ClNa Molecular Weight (g/mol): 58.44 MDL Number: MFCD00003477 InChI Key: FAPWRFPIFSIZLT-UHFFFAOYSA-M IUPAC Name: sodium chloride
| CAS | 7647-14-5 |
|---|---|
| Molecular Weight (g/mol) | 58.44 |
| MDL Number | MFCD00003477 |
| IUPAC Name | sodium chloride |
| InChI Key | FAPWRFPIFSIZLT-UHFFFAOYSA-M |
| Molecular Formula | ClNa |
| Linear Formula | [CH3(CH2)3]4NF |
|---|---|
| Molecular Weight (g/mol) | 261.47 |
| ChEBI | CHEBI:51990 |
| Color | Brown to Green |
| Physical Form | Solution |
| SMILES | [F-].CCCC[N+](CCCC)(CCCC)CCCC |
| Merck Index | 15,9332 |
| InChI Key | FPGGTKZVZWFYPV-UHFFFAOYSA-M |
| Density | 0.8870g/mL |
| PubChem CID | 2724141 |
| Concentration or Composition (by Analyte or Components) | 0.90 to 1.10M |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Wear protective gloves/protective clothing/eye p |
| MDL Number | MFCD00011747 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. Suspected of causing cancer. May cause respiratory irritation. Highly flammable liquid and vapor. May form explosive peroxides. May cause drowsiness or dizzines |
| Flash Point | −17°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | tetrabutylammonium fluoride,tbaf,tetrabutylazanium fluoride,tetrabutyl ammonium fluoride,tetra-n-butylammonium fluoride,tetrabutylamine, fluoride,n,n,n-tributylbutan-1-aminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride,n,n,n-tributyl-1-butanaminium fluoride,1-butanaminium, n,n,n-tributyl-, fluoride 1:1 |
| IUPAC Name | tetrabutylazanium;fluoride |
| Molecular Formula | C16H36FN |
| EINECS Number | 207-057-2 |
| Formula Weight | 261.46 |
| Specific Gravity | 0.887 |
Niobium(V) chloride, 99.95% (metals basis)
CAS: 10026-12-7 Molecular Formula: Cl5Nb Molecular Weight (g/mol): 270.156 MDL Number: MFCD00011127 InChI Key: YHBDIEWMOMLKOO-UHFFFAOYSA-I Synonym: niobium v chloride,niobium pentachloride,niobium chloride nbcl5,nbcl5,columbium pentachloride,niobium v chloride, puratronic,niobium v chloride trace metals basis,niobium v chloride-nb 20-200ppm ta puratrem PubChem CID: 24818 IUPAC Name: pentachloroniobium SMILES: Cl[Nb](Cl)(Cl)(Cl)Cl
| PubChem CID | 24818 |
|---|---|
| CAS | 10026-12-7 |
| Molecular Weight (g/mol) | 270.156 |
| MDL Number | MFCD00011127 |
| SMILES | Cl[Nb](Cl)(Cl)(Cl)Cl |
| Synonym | niobium v chloride,niobium pentachloride,niobium chloride nbcl5,nbcl5,columbium pentachloride,niobium v chloride, puratronic,niobium v chloride trace metals basis,niobium v chloride-nb 20-200ppm ta puratrem |
| IUPAC Name | pentachloroniobium |
| InChI Key | YHBDIEWMOMLKOO-UHFFFAOYSA-I |
| Molecular Formula | Cl5Nb |
Calcium nitrate tetrahydrate, 97+%
CAS: 13477-34-4 Molecular Formula: CaH8N2O10 Molecular Weight (g/mol): 236.15 MDL Number: MFCD00149604 InChI Key: MWGCGFYACDTFSB-UHFFFAOYSA-N Synonym: calcium nitrate tetrahydrate,calcium nitrate hydrate, puratronic,acmc-1aekc,calcium nitrate tetra hydrate,ca.2no3.4h2o,ca no3 2.4h2o,calcium tetrahydrate dinitronate,calcium nitrate-water 1/4,calcium tetrahydrate dinitrate,calcium 2+ tetrahydrate dinitronate PubChem CID: 16211656 ChEBI: CHEBI:86159 IUPAC Name: calcium bis(nitric acid) tetrahydrate SMILES: O.[Ca++].[O-][N+]([O-])=O
| PubChem CID | 16211656 |
|---|---|
| CAS | 13477-34-4 |
| Molecular Weight (g/mol) | 236.15 |
| ChEBI | CHEBI:86159 |
| MDL Number | MFCD00149604 |
| SMILES | O.[Ca++].[O-][N+]([O-])=O |
| Synonym | calcium nitrate tetrahydrate,calcium nitrate hydrate, puratronic,acmc-1aekc,calcium nitrate tetra hydrate,ca.2no3.4h2o,ca no3 2.4h2o,calcium tetrahydrate dinitronate,calcium nitrate-water 1/4,calcium tetrahydrate dinitrate,calcium 2+ tetrahydrate dinitronate |
| IUPAC Name | calcium bis(nitric acid) tetrahydrate |
| InChI Key | MWGCGFYACDTFSB-UHFFFAOYSA-N |
| Molecular Formula | CaH8N2O10 |
Ammonium nitrate, 99+%, for analysis
CAS: 6484-52-2 Molecular Formula: H4N2O3 Molecular Weight (g/mol): 80.04 MDL Number: MFCD00011425 InChI Key: DVARTQFDIMZBAA-UHFFFAOYSA-O Synonym: ammonium nitrate,nitram,ammonium nitricum,ammonium saltpeter,nitrate of ammonia,nitric acid ammonium salt,nitrato amonico,herco prills,german saltpeter,merco prills PubChem CID: 22985 ChEBI: CHEBI:63038 SMILES: [NH4+].[O-][N+]([O-])=O
| PubChem CID | 22985 |
|---|---|
| CAS | 6484-52-2 |
| Molecular Weight (g/mol) | 80.04 |
| ChEBI | CHEBI:63038 |
| MDL Number | MFCD00011425 |
| SMILES | [NH4+].[O-][N+]([O-])=O |
| Synonym | ammonium nitrate,nitram,ammonium nitricum,ammonium saltpeter,nitrate of ammonia,nitric acid ammonium salt,nitrato amonico,herco prills,german saltpeter,merco prills |
| InChI Key | DVARTQFDIMZBAA-UHFFFAOYSA-O |
| Molecular Formula | H4N2O3 |
Dichloroisocyanuric acid sodium salt monohydrate, 97%
CAS: 52671-45-1 Molecular Formula: C3Cl2N3NaO3·H2O Molecular Weight (g/mol): 237.96 InChI Key: FIHQYHSNTSJNGG-UHFFFAOYSA-N Synonym: Sodium dichloroisocyanurate dihydrate PubChem CID: 129893375 IUPAC Name: 1,3-dichloro-1,3,5-triazinane-2,4,6-trione;sodium;dihydrate SMILES: C1(=O)NC(=O)N(C(=O)N1Cl)Cl.O.O.[Na]
| PubChem CID | 129893375 |
|---|---|
| CAS | 52671-45-1 |
| Molecular Weight (g/mol) | 237.96 |
| SMILES | C1(=O)NC(=O)N(C(=O)N1Cl)Cl.O.O.[Na] |
| Synonym | Sodium dichloroisocyanurate dihydrate |
| IUPAC Name | 1,3-dichloro-1,3,5-triazinane-2,4,6-trione;sodium;dihydrate |
| InChI Key | FIHQYHSNTSJNGG-UHFFFAOYSA-N |
| Molecular Formula | C3Cl2N3NaO3·H2O |
Potassium chlorate, 99+%
CAS: 3811-04-9 Molecular Formula: ClKO3 Molecular Weight (g/mol): 122.55 MDL Number: MFCD00011361 InChI Key: VKJKEPKFPUWCAS-UHFFFAOYSA-M Synonym: potassium chlorate,fekabit,potcrate,kaliumchlorat,anforstan,berthollet salt,salt of tarter,berthollet's salt,chlorate of potash,chloric acid, potassium salt PubChem CID: 6426889 IUPAC Name: potassium;chlorate SMILES: [O-]Cl(=O)=O.[K+]
| PubChem CID | 6426889 |
|---|---|
| CAS | 3811-04-9 |
| Molecular Weight (g/mol) | 122.55 |
| MDL Number | MFCD00011361 |
| SMILES | [O-]Cl(=O)=O.[K+] |
| Synonym | potassium chlorate,fekabit,potcrate,kaliumchlorat,anforstan,berthollet salt,salt of tarter,berthollet's salt,chlorate of potash,chloric acid, potassium salt |
| IUPAC Name | potassium;chlorate |
| InChI Key | VKJKEPKFPUWCAS-UHFFFAOYSA-M |
| Molecular Formula | ClKO3 |
Ammonium dihydrogen phosphate, 99+%, for analysis
CAS: 7722-76-1 Molecular Formula: H6NO4P Molecular Weight (g/mol): 115.03 MDL Number: MFCD00003396 InChI Key: LFVGISIMTYGQHF-UHFFFAOYSA-N Synonym: ammonium dihydrogen phosphate,monoammonium phosphate,ammonium biphosphate,ammonium acid phosphate,phosphoric acid, monoammonium salt,ammonium monophosphate,ammonium dihydrogen orthophosphate,ammonium dihydrophosphate,ammonium diacid phosphate,primary ammonium phosphate PubChem CID: 24402 ChEBI: CHEBI:62982 IUPAC Name: phosphoric acid amine SMILES: N.OP(O)(O)=O
| PubChem CID | 24402 |
|---|---|
| CAS | 7722-76-1 |
| Molecular Weight (g/mol) | 115.03 |
| ChEBI | CHEBI:62982 |
| MDL Number | MFCD00003396 |
| SMILES | N.OP(O)(O)=O |
| Synonym | ammonium dihydrogen phosphate,monoammonium phosphate,ammonium biphosphate,ammonium acid phosphate,phosphoric acid, monoammonium salt,ammonium monophosphate,ammonium dihydrogen orthophosphate,ammonium dihydrophosphate,ammonium diacid phosphate,primary ammonium phosphate |
| IUPAC Name | phosphoric acid amine |
| InChI Key | LFVGISIMTYGQHF-UHFFFAOYSA-N |
| Molecular Formula | H6NO4P |
Silver nitrate, 99+%, ACS reagent
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Thermo Scientific Chemicals Sodium nitrate, 99+%, for biochemistry
CAS: 7631-99-4 Molecular Formula: NNaO3 Molecular Weight (g/mol): 84.99 MDL Number: MFCD00011119 InChI Key: VWDWKYIASSYTQR-UHFFFAOYSA-N Synonym: sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 PubChem CID: 24268 ChEBI: CHEBI:63005 SMILES: [Na+].[O-][N+]([O-])=O
| PubChem CID | 24268 |
|---|---|
| CAS | 7631-99-4 |
| Molecular Weight (g/mol) | 84.99 |
| ChEBI | CHEBI:63005 |
| MDL Number | MFCD00011119 |
| SMILES | [Na+].[O-][N+]([O-])=O |
| Synonym | sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 |
| InChI Key | VWDWKYIASSYTQR-UHFFFAOYSA-N |
| Molecular Formula | NNaO3 |
Lithium metaborate, Puratronic™, 99.997% (metals basis)
CAS: 13453-69-5 Molecular Formula: B4H14Li2O7 Molecular Weight (g/mol): 183.23 MDL Number: MFCD00011089 InChI Key: DPYKRXYVXDYLEY-UHFFFAOYSA-N Synonym: lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs PubChem CID: 123308 SMILES: [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O
| PubChem CID | 123308 |
|---|---|
| CAS | 13453-69-5 |
| Molecular Weight (g/mol) | 183.23 |
| MDL Number | MFCD00011089 |
| SMILES | [Li].[Li].[B].[B].[B].[B].O.O.O.O.O.O.O |
| Synonym | lithium metaborate,boric acid hbo2 , lithium salt,lithium metaborate, anhydrous,lithium oxido oxo borane,bo2.li,boric acid hbo2 , lithium salt 1:1,lithium metaborate,anhydrous,lithium metaborate, puratronic,lithotab boron oxide hydroxide,lithium metaborate, acs |
| InChI Key | DPYKRXYVXDYLEY-UHFFFAOYSA-N |
| Molecular Formula | B4H14Li2O7 |
Aluminum foil, 0.1mm (0.004in) thick, 99.99% (metals basis)
CAS: 7429-90-5 Molecular Formula: Al Molecular Weight (g/mol): 26.98 MDL Number: MFCD00134029 InChI Key: XAGFODPZIPBFFR-UHFFFAOYSA-N Synonym: aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum PubChem CID: 5359268 ChEBI: CHEBI:33629 IUPAC Name: aluminum SMILES: [Al]
| PubChem CID | 5359268 |
|---|---|
| CAS | 7429-90-5 |
| Molecular Weight (g/mol) | 26.98 |
| ChEBI | CHEBI:33629 |
| MDL Number | MFCD00134029 |
| SMILES | [Al] |
| Synonym | aluminum,metal,powder,aluminio,metana,adom,alumina fibre,aluminum flake,dust,noral aluminum |
| IUPAC Name | aluminum |
| InChI Key | XAGFODPZIPBFFR-UHFFFAOYSA-N |
| Molecular Formula | Al |
Iron(III) oxide, 99.9% (metals basis), Thermo Scientific Chemicals
CAS: 1309-37-1 Molecular Formula: Fe2O3 Molecular Weight (g/mol): 159.69 MDL Number: MFCD00011008 InChI Key: JEIPFZHSYJVQDO-UHFFFAOYSA-N IUPAC Name: trioxodiiron SMILES: [Fe][Fe](=O)(=O)=O
| CAS | 1309-37-1 |
|---|---|
| Molecular Weight (g/mol) | 159.69 |
| MDL Number | MFCD00011008 |
| SMILES | [Fe][Fe](=O)(=O)=O |
| IUPAC Name | trioxodiiron |
| InChI Key | JEIPFZHSYJVQDO-UHFFFAOYSA-N |
| Molecular Formula | Fe2O3 |
Sodium hypochlorite, 4-6%
CAS: 7681-52-9 Molecular Formula: ClNaO Molecular Weight (g/mol): 74.44 MDL Number: MFCD00011120 InChI Key: SUKJFIGYRHOWBL-UHFFFAOYSA-N Synonym: sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution PubChem CID: 23665760 ChEBI: CHEBI:32146 IUPAC Name: sodium;hypochlorite SMILES: [O-]Cl.[Na+]
| PubChem CID | 23665760 |
|---|---|
| CAS | 7681-52-9 |
| Molecular Weight (g/mol) | 74.44 |
| ChEBI | CHEBI:32146 |
| MDL Number | MFCD00011120 |
| SMILES | [O-]Cl.[Na+] |
| Synonym | sodium hypochlorite,antiformin,sodium oxychloride,chlorox,clorox,javex,javelle water,hypochlorous acid, sodium salt,hypochlorite sodium,carrel-dakin solution |
| IUPAC Name | sodium;hypochlorite |
| InChI Key | SUKJFIGYRHOWBL-UHFFFAOYSA-N |
| Molecular Formula | ClNaO |